C16H19BrN5O3+ — CID 135701433
1-(4-bromophenyl)-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 135701433) has the molecular formula C16H19BrN5O3+ and a molecular weight of 409.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-bromophenyl)-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135701433 |
| Molecular Formula | C16H19BrN5O3+ |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 1-(4-bromophenyl)-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | C[NH+]1CCN(/N=C/c2c(O)n(-c3ccc(Br)cc3)c(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C16H18BrN5O3/c1-20-6-8-21(9-7-20)18-10-13-14(23)19-16(25)22(15(13)24)12-4-2-11(17)3-5-12/h2-5,10,24H,6-9H2,1H3,(H,19,23,25)/p+1/b18-10+ |
| InChIKey | ZNXYERASUWZAHO-VCHYOVAHSA-O |
| XLogP | -0.84 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|