C20H28N5O5+ — CID 135597149
1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione (PubChem CID 135597149) has the molecular formula C20H28N5O5+ and a molecular weight of 418.47 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135597149 |
| Molecular Formula | C20H28N5O5+ |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-6-hydroxy-5-[(E)-(4-methylpiperazin-4-ium-1-yl)iminomethyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(CCn2c(O)c(/C=N/N3CC[NH+](C)CC3)c(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C20H27N5O5/c1-23-8-10-24(11-9-23)21-13-15-18(26)22-20(28)25(19(15)27)7-6-14-4-5-16(29-2)17(12-14)30-3/h4-5,12-13,27H,6-11H2,1-3H3,(H,22,26,28)/p+1/b21-13+ |
| InChIKey | SWDFWEOZHFOKCS-FYJGNVAPSA-O |
| XLogP | -1.33 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|