C27H32N4O5 — CID 4977134
5-[(1-benzylpiperidin-1-ium-4-yl)iminomethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dioxopyrimidin-4-olate (PubChem CID 4977134) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is 5-[(1-benzylpiperidin-1-ium-4-yl)iminomethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dioxopyrimidin-4-olate.
| Compound Name | 5-[(1-benzylpiperidin-1-ium-4-yl)iminomethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dioxopyrimidin-4-olate |
|---|---|
| PubChem CID | 4977134 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 5-[(1-benzylpiperidin-1-ium-4-yl)iminomethyl]-3-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dioxopyrimidin-4-olate |
| SMILES | COc1ccc(CCn2c([O-])c(/C=N/C3CC[NH+](Cc4ccccc4)CC3)c(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C27H32N4O5/c1-35-23-9-8-19(16-24(23)36-2)10-15-31-26(33)22(25(32)29-27(31)34)17-28-21-11-13-30(14-12-21)18-20-6-4-3-5-7-20/h3-9,16-17,21,33H,10-15,18H2,1-2H3,(H,29,32,34)/b28-17+ |
| InChIKey | ZHHFBJURLWFDNE-OGLMXYFKSA-N |
| XLogP | 0.54 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|