C30H28N2O8 — CID 2731133
2,6-bis[2-(3,4-dimethoxyphenyl)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 2731133) has the molecular formula C30H28N2O8 and a molecular weight of 544.56 g/mol. Its IUPAC name is 2,6-bis[2-(3,4-dimethoxyphenyl)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[2-(3,4-dimethoxyphenyl)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 2731133 |
| Molecular Formula | C30H28N2O8 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 2,6-bis[2-(3,4-dimethoxyphenyl)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | COc1ccc(CCn2c(=O)c3cc4c(=O)n(CCc5ccc(OC)c(OC)c5)c(=O)c4cc3c2=O)cc1OC |
| InChI | InChI=1S/C30H28N2O8/c1-37-23-7-5-17(13-25(23)39-3)9-11-31-27(33)19-15-21-22(16-20(19)28(31)34)30(36)32(29(21)35)12-10-18-6-8-24(38-2)26(14-18)40-4/h5-8,13-16H,9-12H2,1-4H3 |
| InChIKey | VCWWYWHXLFMROL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 115.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |