C32H34N2O8 — CID 92531936
(2S,6S,8R,12R)-4,10-bis[2-(3,4-dimethoxyphenyl)ethyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone (PubChem CID 92531936) has the molecular formula C32H34N2O8 and a molecular weight of 574.63 g/mol. Its IUPAC name is (2S,6S,8R,12R)-4,10-bis[2-(3,4-dimethoxyphenyl)ethyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone.
| Compound Name | (2S,6S,8R,12R)-4,10-bis[2-(3,4-dimethoxyphenyl)ethyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
|---|---|
| PubChem CID | 92531936 |
| Molecular Formula | C32H34N2O8 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | (2S,6S,8R,12R)-4,10-bis[2-(3,4-dimethoxyphenyl)ethyl]-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5,9,11-tetrone |
| SMILES | COc1ccc(CCN2C(=O)[C@@H]3C4C=CC([C@H]3C2=O)[C@@H]2C(=O)N(CCc3ccc(OC)c(OC)c3)C(=O)[C@@H]42)cc1OC |
| InChI | InChI=1S/C32H34N2O8/c1-39-21-9-5-17(15-23(21)41-3)11-13-33-29(35)25-19-7-8-20(26(25)30(33)36)28-27(19)31(37)34(32(28)38)14-12-18-6-10-22(40-2)24(16-18)42-4/h5-10,15-16,19-20,25-28H,11-14H2,1-4H3/t19?,20?,25-,26-,27+,28+ |
| InChIKey | UGZMPGJVXRAOPR-ACTZSYJRSA-N |
| XLogP | 2.52 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|