C21H22N2O7 — CID 99720116
(1S,2S,6R,7R,8S,12S)-10-[2-(3,4-dimethoxyphenyl)ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylic acid (PubChem CID 99720116) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is (1S,2S,6R,7R,8S,12S)-10-[2-(3,4-dimethoxyphenyl)ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylic acid.
| Compound Name | (1S,2S,6R,7R,8S,12S)-10-[2-(3,4-dimethoxyphenyl)ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylic acid |
|---|---|
| PubChem CID | 99720116 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (1S,2S,6R,7R,8S,12S)-10-[2-(3,4-dimethoxyphenyl)ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylic acid |
| SMILES | COc1ccc(CCN2C(=O)[C@H]3[C@@H]4C[C@H]([C@@H]5C(C(=O)O)=NO[C@@H]45)[C@@H]3C2=O)cc1OC |
| InChI | InChI=1S/C21H22N2O7/c1-28-12-4-3-9(7-13(12)29-2)5-6-23-19(24)14-10-8-11(15(14)20(23)25)18-16(10)17(21(26)27)22-30-18/h3-4,7,10-11,14-16,18H,5-6,8H2,1-2H3,(H,26,27)/t10-,11-,14-,15-,16+,18-/m0/s1 |
| InChIKey | BGTZBWJPVIPYKC-WMGTXGPZSA-N |
| XLogP | 0.95 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|