C14H17NO6 — CID 10870149
(3R,4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dihydroxypyrrolidine-2,5-dione (PubChem CID 10870149) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is (3R,4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dihydroxypyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dihydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 10870149 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (3R,4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-dihydroxypyrrolidine-2,5-dione |
| SMILES | COc1ccc(CCN2C(=O)[C@H](O)[C@@H](O)C2=O)cc1OC |
| InChI | InChI=1S/C14H17NO6/c1-20-9-4-3-8(7-10(9)21-2)5-6-15-13(18)11(16)12(17)14(15)19/h3-4,7,11-12,16-17H,5-6H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | KTUFVFGTYGMEBM-VXGBXAGGSA-N |
| XLogP | -0.66 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|