C20H33NO6Si2 — CID 11236001
(3R,4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-bis(trimethylsilyloxy)pyrrolidine-2,5-dione (PubChem CID 11236001) has the molecular formula C20H33NO6Si2 and a molecular weight of 439.66 g/mol. Its IUPAC name is (3R,4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-bis(trimethylsilyloxy)pyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-bis(trimethylsilyloxy)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11236001 |
| Molecular Formula | C20H33NO6Si2 |
| Molecular Weight | 439.66 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (3R,4R)-1-[2-(3,4-dimethoxyphenyl)ethyl]-3,4-bis(trimethylsilyloxy)pyrrolidine-2,5-dione |
| SMILES | COc1ccc(CCN2C(=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C2=O)cc1OC |
| InChI | InChI=1S/C20H33NO6Si2/c1-24-15-10-9-14(13-16(15)25-2)11-12-21-19(22)17(26-28(3,4)5)18(20(21)23)27-29(6,7)8/h9-10,13,17-18H,11-12H2,1-8H3/t17-,18-/m1/s1 |
| InChIKey | RYXNOPCKVPDQSK-QZTJIDSGSA-N |
| XLogP | 3.06 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.66 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|