C30H32N2O12S2 — CID 139144368
2,6-bis[2-(3,4-dihydroxyphenyl)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone;methylsulfonylmethane (PubChem CID 139144368) has the molecular formula C30H32N2O12S2 and a molecular weight of 676.72 g/mol. Its IUPAC name is 2,6-bis[2-(3,4-dihydroxyphenyl)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone;methylsulfonylmethane.
| Compound Name | 2,6-bis[2-(3,4-dihydroxyphenyl)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone;methylsulfonylmethane |
|---|---|
| PubChem CID | 139144368 |
| Molecular Formula | C30H32N2O12S2 |
| Molecular Weight | 676.72 g/mol |
| Exact Mass | 676.14 |
| IUPAC Name | 2,6-bis[2-(3,4-dihydroxyphenyl)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone;methylsulfonylmethane |
| SMILES | CS(C)(=O)=O.CS(C)(=O)=O.O=c1c2cc3c(=O)n(CCc4ccc(O)c(O)c4)c(=O)c3cc2c(=O)n1CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C26H20N2O8.2C2H6O2S/c29-19-3-1-13(9-21(19)31)5-7-27-23(33)15-11-17-18(12-16(15)24(27)34)26(36)28(25(17)35)8-6-14-2-4-20(30)22(32)10-14;2*1-5(2,3)4/h1-4,9-12,29-32H,5-8H2;2*1-2H3 |
| InChIKey | WDWYQFGVVVHTLQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 227.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.72 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|