C10H17FINO2 — CID 158050846
fluoro-methyl-tritio-λ3-iodane;4-[2-(methylamino)ethyl]benzene-1,2-diol (PubChem CID 158050846) has the molecular formula C10H17FINO2 and a molecular weight of 331.16 g/mol. Its IUPAC name is fluoro-methyl-tritio-λ3-iodane;4-[2-(methylamino)ethyl]benzene-1,2-diol.
| Compound Name | fluoro-methyl-tritio-λ3-iodane;4-[2-(methylamino)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 158050846 |
| Molecular Formula | C10H17FINO2 |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | fluoro-methyl-tritio-λ3-iodane;4-[2-(methylamino)ethyl]benzene-1,2-diol |
| SMILES | CNCCc1ccc(O)c(O)c1.[3H]I(C)F |
| InChI | InChI=1S/C9H13NO2.CH4FI/c1-10-5-4-7-2-3-8(11)9(12)6-7;1-3-2/h2-3,6,10-12H,4-5H2,1H3;3H,1H3/i;3T |
| InChIKey | FJLQTRFCOLKFIT-LXUHVUQPSA-N |
| XLogP | 2.06 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|