C24H21N3O6 — CID 151448807
4-[[3-[2-(3,4-dihydroxyphenyl)ethyl]-2,4-dioxoquinazolin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 151448807) has the molecular formula C24H21N3O6 and a molecular weight of 447.45 g/mol. Its IUPAC name is 4-[[3-[2-(3,4-dihydroxyphenyl)ethyl]-2,4-dioxoquinazolin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[3-[2-(3,4-dihydroxyphenyl)ethyl]-2,4-dioxoquinazolin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 151448807 |
| Molecular Formula | C24H21N3O6 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 4-[[3-[2-(3,4-dihydroxyphenyl)ethyl]-2,4-dioxoquinazolin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(Cn2c(=O)n(CCc3ccc(O)c(O)c3)c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H21N3O6/c28-20-10-7-15(13-21(20)29)11-12-26-23(31)18-3-1-2-4-19(18)27(24(26)32)14-16-5-8-17(9-6-16)22(30)25-33/h1-10,13,28-29,33H,11-12,14H2,(H,25,30) |
| InChIKey | PGBHASGHEGUOFT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|