C24H27N3O6 — CID 151253154
4-[[3-[2-(1,2-dihydroxycyclohexyl)ethyl]-2,4-dioxoquinazolin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 151253154) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is 4-[[3-[2-(1,2-dihydroxycyclohexyl)ethyl]-2,4-dioxoquinazolin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[3-[2-(1,2-dihydroxycyclohexyl)ethyl]-2,4-dioxoquinazolin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 151253154 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 4-[[3-[2-(1,2-dihydroxycyclohexyl)ethyl]-2,4-dioxoquinazolin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(Cn2c(=O)n(CCC3(O)CCCCC3O)c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H27N3O6/c28-20-7-3-4-12-24(20,32)13-14-26-22(30)18-5-1-2-6-19(18)27(23(26)31)15-16-8-10-17(11-9-16)21(29)25-33/h1-2,5-6,8-11,20,28,32-33H,3-4,7,12-15H2,(H,25,29) |
| InChIKey | NSTLJWYJODGNBI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|