C22H24N4O4 — CID 150096934
N-hydroxy-4-[[3-(1-methylpiperidin-4-yl)-2,4-dioxoquinazolin-1-yl]methyl]benzamide (PubChem CID 150096934) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-hydroxy-4-[[3-(1-methylpiperidin-4-yl)-2,4-dioxoquinazolin-1-yl]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[3-(1-methylpiperidin-4-yl)-2,4-dioxoquinazolin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 150096934 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-hydroxy-4-[[3-(1-methylpiperidin-4-yl)-2,4-dioxoquinazolin-1-yl]methyl]benzamide |
| SMILES | CN1CCC(n2c(=O)c3ccccc3n(Cc3ccc(C(=O)NO)cc3)c2=O)CC1 |
| InChI | InChI=1S/C22H24N4O4/c1-24-12-10-17(11-13-24)26-21(28)18-4-2-3-5-19(18)25(22(26)29)14-15-6-8-16(9-7-15)20(27)23-30/h2-9,17,30H,10-14H2,1H3,(H,23,27) |
| InChIKey | DULAGHGTHPQQIJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|