C25H28BrN3O3 — CID 50742795
5-[1-[(4-bromophenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-cyclopentylpentanamide (PubChem CID 50742795) has the molecular formula C25H28BrN3O3 and a molecular weight of 498.42 g/mol. Its IUPAC name is 5-[1-[(4-bromophenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-cyclopentylpentanamide.
| Compound Name | 5-[1-[(4-bromophenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-cyclopentylpentanamide |
|---|---|
| PubChem CID | 50742795 |
| Molecular Formula | C25H28BrN3O3 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 5-[1-[(4-bromophenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-cyclopentylpentanamide |
| SMILES | O=C(CCCCn1c(=O)c2ccccc2n(Cc2ccc(Br)cc2)c1=O)NC1CCCC1 |
| InChI | InChI=1S/C25H28BrN3O3/c26-19-14-12-18(13-15-19)17-29-22-10-4-3-9-21(22)24(31)28(25(29)32)16-6-5-11-23(30)27-20-7-1-2-8-20/h3-4,9-10,12-15,20H,1-2,5-8,11,16-17H2,(H,27,30) |
| InChIKey | CDXJWEIYIUJCES-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|