C26H29ClFN3O3 — CID 50742858
5-[1-[(2-chloro-4-fluorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-cyclohexylpentanamide (PubChem CID 50742858) has the molecular formula C26H29ClFN3O3 and a molecular weight of 485.99 g/mol. Its IUPAC name is 5-[1-[(2-chloro-4-fluorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-cyclohexylpentanamide.
| Compound Name | 5-[1-[(2-chloro-4-fluorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-cyclohexylpentanamide |
|---|---|
| PubChem CID | 50742858 |
| Molecular Formula | C26H29ClFN3O3 |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | 5-[1-[(2-chloro-4-fluorophenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-cyclohexylpentanamide |
| SMILES | O=C(CCCCn1c(=O)c2ccccc2n(Cc2ccc(F)cc2Cl)c1=O)NC1CCCCC1 |
| InChI | InChI=1S/C26H29ClFN3O3/c27-22-16-19(28)14-13-18(22)17-31-23-11-5-4-10-21(23)25(33)30(26(31)34)15-7-6-12-24(32)29-20-8-2-1-3-9-20/h4-5,10-11,13-14,16,20H,1-3,6-9,12,15,17H2,(H,29,32) |
| InChIKey | NBTLPNMLAKUDSS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|