C29H36N4O4 — CID 50762987
N-cyclohexyl-5-[1-[2-(3-ethylanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]pentanamide (PubChem CID 50762987) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is N-cyclohexyl-5-[1-[2-(3-ethylanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]pentanamide.
| Compound Name | N-cyclohexyl-5-[1-[2-(3-ethylanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]pentanamide |
|---|---|
| PubChem CID | 50762987 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | N-cyclohexyl-5-[1-[2-(3-ethylanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]pentanamide |
| SMILES | CCc1cccc(NC(=O)Cn2c(=O)n(CCCCC(=O)NC3CCCCC3)c(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C29H36N4O4/c1-2-21-11-10-14-23(19-21)31-27(35)20-33-25-16-7-6-15-24(25)28(36)32(29(33)37)18-9-8-17-26(34)30-22-12-4-3-5-13-22/h6-7,10-11,14-16,19,22H,2-5,8-9,12-13,17-18,20H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | KQQAGCFCPWCBNG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|