C28H34N4O4 — CID 50762788
5-[1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(4-methylphenyl)pentanamide (PubChem CID 50762788) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is 5-[1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(4-methylphenyl)pentanamide.
| Compound Name | 5-[1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(4-methylphenyl)pentanamide |
|---|---|
| PubChem CID | 50762788 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 5-[1-[2-(cyclohexylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(4-methylphenyl)pentanamide |
| SMILES | Cc1ccc(NC(=O)CCCCn2c(=O)c3ccccc3n(CC(=O)NC3CCCCC3)c2=O)cc1 |
| InChI | InChI=1S/C28H34N4O4/c1-20-14-16-22(17-15-20)29-25(33)13-7-8-18-31-27(35)23-11-5-6-12-24(23)32(28(31)36)19-26(34)30-21-9-3-2-4-10-21/h5-6,11-12,14-17,21H,2-4,7-10,13,18-19H2,1H3,(H,29,33)(H,30,34) |
| InChIKey | YSUSFVRHAYMVAY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|