C27H28N4O5 — CID 50762811
5-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(4-methylphenyl)pentanamide (PubChem CID 50762811) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is 5-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(4-methylphenyl)pentanamide.
| Compound Name | 5-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(4-methylphenyl)pentanamide |
|---|---|
| PubChem CID | 50762811 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 5-[1-[2-(furan-2-ylmethylamino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(4-methylphenyl)pentanamide |
| SMILES | Cc1ccc(NC(=O)CCCCn2c(=O)c3ccccc3n(CC(=O)NCc3ccco3)c2=O)cc1 |
| InChI | InChI=1S/C27H28N4O5/c1-19-11-13-20(14-12-19)29-24(32)10-4-5-15-30-26(34)22-8-2-3-9-23(22)31(27(30)35)18-25(33)28-17-21-7-6-16-36-21/h2-3,6-9,11-14,16H,4-5,10,15,17-18H2,1H3,(H,28,33)(H,29,32) |
| InChIKey | OYLHWKSEJTYEJB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|