C27H27ClN4O6 — CID 22429577
5-[1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(furan-2-ylmethyl)pentanamide (PubChem CID 22429577) has the molecular formula C27H27ClN4O6 and a molecular weight of 538.99 g/mol. Its IUPAC name is 5-[1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(furan-2-ylmethyl)pentanamide.
| Compound Name | 5-[1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(furan-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 22429577 |
| Molecular Formula | C27H27ClN4O6 |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.16 |
| IUPAC Name | 5-[1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(furan-2-ylmethyl)pentanamide |
| SMILES | COc1ccc(NC(=O)Cn2c(=O)n(CCCCC(=O)NCc3ccco3)c(=O)c3ccccc32)cc1Cl |
| InChI | InChI=1S/C27H27ClN4O6/c1-37-23-12-11-18(15-21(23)28)30-25(34)17-32-22-9-3-2-8-20(22)26(35)31(27(32)36)13-5-4-10-24(33)29-16-19-7-6-14-38-19/h2-3,6-9,11-12,14-15H,4-5,10,13,16-17H2,1H3,(H,29,33)(H,30,34) |
| InChIKey | JQJMPAMFLFOMJB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|