C28H26Cl2N4O4 — CID 46247690
5-[1-[2-(3-chloroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-[(2-chlorophenyl)methyl]pentanamide (PubChem CID 46247690) has the molecular formula C28H26Cl2N4O4 and a molecular weight of 553.45 g/mol. Its IUPAC name is 5-[1-[2-(3-chloroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-[(2-chlorophenyl)methyl]pentanamide.
| Compound Name | 5-[1-[2-(3-chloroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-[(2-chlorophenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 46247690 |
| Molecular Formula | C28H26Cl2N4O4 |
| Molecular Weight | 553.45 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | 5-[1-[2-(3-chloroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-[(2-chlorophenyl)methyl]pentanamide |
| SMILES | O=C(CCCCn1c(=O)c2ccccc2n(CC(=O)Nc2cccc(Cl)c2)c1=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C28H26Cl2N4O4/c29-20-9-7-10-21(16-20)32-26(36)18-34-24-13-4-2-11-22(24)27(37)33(28(34)38)15-6-5-14-25(35)31-17-19-8-1-3-12-23(19)30/h1-4,7-13,16H,5-6,14-15,17-18H2,(H,31,35)(H,32,36) |
| InChIKey | IHBANFQVTLUWND-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.45 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|