C30H31ClN4O4 — CID 22429771
N-[(2-chlorophenyl)methyl]-5-[1-[2-(2,4-dimethylanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]pentanamide (PubChem CID 22429771) has the molecular formula C30H31ClN4O4 and a molecular weight of 547.06 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-5-[1-[2-(2,4-dimethylanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]pentanamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-5-[1-[2-(2,4-dimethylanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]pentanamide |
|---|---|
| PubChem CID | 22429771 |
| Molecular Formula | C30H31ClN4O4 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-5-[1-[2-(2,4-dimethylanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]pentanamide |
| SMILES | Cc1ccc(NC(=O)Cn2c(=O)n(CCCCC(=O)NCc3ccccc3Cl)c(=O)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C30H31ClN4O4/c1-20-14-15-25(21(2)17-20)33-28(37)19-35-26-12-6-4-10-23(26)29(38)34(30(35)39)16-8-7-13-27(36)32-18-22-9-3-5-11-24(22)31/h3-6,9-12,14-15,17H,7-8,13,16,18-19H2,1-2H3,(H,32,36)(H,33,37) |
| InChIKey | KUYOSHQBNFHEPA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|