C27H26N4O4 — CID 50763061
5-[1-(2-anilino-2-oxoethyl)-2,4-dioxoquinazolin-3-yl]-N-phenylpentanamide (PubChem CID 50763061) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 5-[1-(2-anilino-2-oxoethyl)-2,4-dioxoquinazolin-3-yl]-N-phenylpentanamide.
| Compound Name | 5-[1-(2-anilino-2-oxoethyl)-2,4-dioxoquinazolin-3-yl]-N-phenylpentanamide |
|---|---|
| PubChem CID | 50763061 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 5-[1-(2-anilino-2-oxoethyl)-2,4-dioxoquinazolin-3-yl]-N-phenylpentanamide |
| SMILES | O=C(CCCCn1c(=O)c2ccccc2n(CC(=O)Nc2ccccc2)c1=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H26N4O4/c32-24(28-20-11-3-1-4-12-20)17-9-10-18-30-26(34)22-15-7-8-16-23(22)31(27(30)35)19-25(33)29-21-13-5-2-6-14-21/h1-8,11-16H,9-10,17-19H2,(H,28,32)(H,29,33) |
| InChIKey | KFNASENRJPCIFV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|