C26H30N4O6 — CID 27371261
methyl 4-[[2-[2,4-dioxo-3-[5-oxo-5-(propan-2-ylamino)pentyl]quinazolin-1-yl]acetyl]amino]benzoate (PubChem CID 27371261) has the molecular formula C26H30N4O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is methyl 4-[[2-[2,4-dioxo-3-[5-oxo-5-(propan-2-ylamino)pentyl]quinazolin-1-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[2,4-dioxo-3-[5-oxo-5-(propan-2-ylamino)pentyl]quinazolin-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 27371261 |
| Molecular Formula | C26H30N4O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | methyl 4-[[2-[2,4-dioxo-3-[5-oxo-5-(propan-2-ylamino)pentyl]quinazolin-1-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Cn2c(=O)n(CCCCC(=O)NC(C)C)c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H30N4O6/c1-17(2)27-22(31)10-6-7-15-29-24(33)20-8-4-5-9-21(20)30(26(29)35)16-23(32)28-19-13-11-18(12-14-19)25(34)36-3/h4-5,8-9,11-14,17H,6-7,10,15-16H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | DUYJKNZNEKWMGP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 128.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|