C21H22FN3O3 — CID 46860909
2-(2,4-dioxo-3-pentylquinazolin-1-yl)-N-(4-fluorophenyl)acetamide (PubChem CID 46860909) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-(2,4-dioxo-3-pentylquinazolin-1-yl)-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(2,4-dioxo-3-pentylquinazolin-1-yl)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 46860909 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-(2,4-dioxo-3-pentylquinazolin-1-yl)-N-(4-fluorophenyl)acetamide |
| SMILES | CCCCCn1c(=O)c2ccccc2n(CC(=O)Nc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C21H22FN3O3/c1-2-3-6-13-24-20(27)17-7-4-5-8-18(17)25(21(24)28)14-19(26)23-16-11-9-15(22)10-12-16/h4-5,7-12H,2-3,6,13-14H2,1H3,(H,23,26) |
| InChIKey | YZTZXXUSALMHJI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|