C23H27N3O3 — CID 46860920
N-(2,6-dimethylphenyl)-2-(2,4-dioxo-3-pentylquinazolin-1-yl)acetamide (PubChem CID 46860920) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-(2,4-dioxo-3-pentylquinazolin-1-yl)acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-(2,4-dioxo-3-pentylquinazolin-1-yl)acetamide |
|---|---|
| PubChem CID | 46860920 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-(2,4-dioxo-3-pentylquinazolin-1-yl)acetamide |
| SMILES | CCCCCn1c(=O)c2ccccc2n(CC(=O)Nc2c(C)cccc2C)c1=O |
| InChI | InChI=1S/C23H27N3O3/c1-4-5-8-14-25-22(28)18-12-6-7-13-19(18)26(23(25)29)15-20(27)24-21-16(2)10-9-11-17(21)3/h6-7,9-13H,4-5,8,14-15H2,1-3H3,(H,24,27) |
| InChIKey | RFTQWZKLBKKLTE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|