C21H23N3O4 — CID 6502256
2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]-N-(2-methylphenyl)acetamide (PubChem CID 6502256) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 6502256 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]-N-(2-methylphenyl)acetamide |
| SMILES | COCCCn1c(=O)c2ccccc2n(CC(=O)Nc2ccccc2C)c1=O |
| InChI | InChI=1S/C21H23N3O4/c1-15-8-3-5-10-17(15)22-19(25)14-24-18-11-6-4-9-16(18)20(26)23(21(24)27)12-7-13-28-2/h3-6,8-11H,7,12-14H2,1-2H3,(H,22,25) |
| InChIKey | BOLKXHVFQRBYGW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|