C20H19ClFN3O4 — CID 51046805
N-(4-chloro-2-fluorophenyl)-2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetamide (PubChem CID 51046805) has the molecular formula C20H19ClFN3O4 and a molecular weight of 419.84 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetamide |
|---|---|
| PubChem CID | 51046805 |
| Molecular Formula | C20H19ClFN3O4 |
| Molecular Weight | 419.84 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-2-[3-(3-methoxypropyl)-2,4-dioxoquinazolin-1-yl]acetamide |
| SMILES | COCCCn1c(=O)c2ccccc2n(CC(=O)Nc2ccc(Cl)cc2F)c1=O |
| InChI | InChI=1S/C20H19ClFN3O4/c1-29-10-4-9-24-19(27)14-5-2-3-6-17(14)25(20(24)28)12-18(26)23-16-8-7-13(21)11-15(16)22/h2-3,5-8,11H,4,9-10,12H2,1H3,(H,23,26) |
| InChIKey | OEDNGDSXPKMVQA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|