C21H22FN3O3 — CID 45030686
2-(3-butyl-2,4-dioxoquinazolin-1-yl)-N-(4-fluoro-2-methylphenyl)acetamide (PubChem CID 45030686) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is 2-(3-butyl-2,4-dioxoquinazolin-1-yl)-N-(4-fluoro-2-methylphenyl)acetamide.
| Compound Name | 2-(3-butyl-2,4-dioxoquinazolin-1-yl)-N-(4-fluoro-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 45030686 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-(3-butyl-2,4-dioxoquinazolin-1-yl)-N-(4-fluoro-2-methylphenyl)acetamide |
| SMILES | CCCCn1c(=O)c2ccccc2n(CC(=O)Nc2ccc(F)cc2C)c1=O |
| InChI | InChI=1S/C21H22FN3O3/c1-3-4-11-24-20(27)16-7-5-6-8-18(16)25(21(24)28)13-19(26)23-17-10-9-15(22)12-14(17)2/h5-10,12H,3-4,11,13H2,1-2H3,(H,23,26) |
| InChIKey | XNWNOCNWJCFIJU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |