C26H24F2N4O4S — CID 50742864
5-[1-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(thiophen-2-ylmethyl)pentanamide (PubChem CID 50742864) has the molecular formula C26H24F2N4O4S and a molecular weight of 526.57 g/mol. Its IUPAC name is 5-[1-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(thiophen-2-ylmethyl)pentanamide.
| Compound Name | 5-[1-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(thiophen-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 50742864 |
| Molecular Formula | C26H24F2N4O4S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | 5-[1-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-(thiophen-2-ylmethyl)pentanamide |
| SMILES | O=C(CCCCn1c(=O)c2ccccc2n(CC(=O)Nc2ccc(F)cc2F)c1=O)NCc1cccs1 |
| InChI | InChI=1S/C26H24F2N4O4S/c27-17-10-11-21(20(28)14-17)30-24(34)16-32-22-8-2-1-7-19(22)25(35)31(26(32)36)12-4-3-9-23(33)29-15-18-6-5-13-37-18/h1-2,5-8,10-11,13-14H,3-4,9,12,15-16H2,(H,29,33)(H,30,34) |
| InChIKey | FUCBXAGLYRGRRF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|