C26H27N3O3S — CID 50763304
5-[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-(thiophen-2-ylmethyl)pentanamide (PubChem CID 50763304) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 5-[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-(thiophen-2-ylmethyl)pentanamide.
| Compound Name | 5-[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-(thiophen-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 50763304 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 5-[1-[(4-methylphenyl)methyl]-2,4-dioxoquinazolin-3-yl]-N-(thiophen-2-ylmethyl)pentanamide |
| SMILES | Cc1ccc(Cn2c(=O)n(CCCCC(=O)NCc3cccs3)c(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H27N3O3S/c1-19-11-13-20(14-12-19)18-29-23-9-3-2-8-22(23)25(31)28(26(29)32)15-5-4-10-24(30)27-17-21-7-6-16-33-21/h2-3,6-9,11-14,16H,4-5,10,15,17-18H2,1H3,(H,27,30) |
| InChIKey | SFACDPBOEQUFDF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|