C19H18N4O2S — CID 20892920
4-(4-oxo-3H-pyridazino[4,5-b]indol-5-yl)-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 20892920) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 4-(4-oxo-3H-pyridazino[4,5-b]indol-5-yl)-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | 4-(4-oxo-3H-pyridazino[4,5-b]indol-5-yl)-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 20892920 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-(4-oxo-3H-pyridazino[4,5-b]indol-5-yl)-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | O=C(CCCn1c2ccccc2c2cn[nH]c(=O)c21)NCc1cccs1 |
| InChI | InChI=1S/C19H18N4O2S/c24-17(20-11-13-5-4-10-26-13)8-3-9-23-16-7-2-1-6-14(16)15-12-21-22-19(25)18(15)23/h1-2,4-7,10,12H,3,8-9,11H2,(H,20,24)(H,22,25) |
| InChIKey | BJZDZZHJWCMEGI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |