C20H19N5O2 — CID 20892895
4-(4-oxo-3H-pyridazino[4,5-b]indol-5-yl)-N-(pyridin-3-ylmethyl)butanamide (PubChem CID 20892895) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 4-(4-oxo-3H-pyridazino[4,5-b]indol-5-yl)-N-(pyridin-3-ylmethyl)butanamide.
| Compound Name | 4-(4-oxo-3H-pyridazino[4,5-b]indol-5-yl)-N-(pyridin-3-ylmethyl)butanamide |
|---|---|
| PubChem CID | 20892895 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 4-(4-oxo-3H-pyridazino[4,5-b]indol-5-yl)-N-(pyridin-3-ylmethyl)butanamide |
| SMILES | O=C(CCCn1c2ccccc2c2cn[nH]c(=O)c21)NCc1cccnc1 |
| InChI | InChI=1S/C20H19N5O2/c26-18(22-12-14-5-3-9-21-11-14)8-4-10-25-17-7-2-1-6-15(17)16-13-23-24-20(27)19(16)25/h1-3,5-7,9,11,13H,4,8,10,12H2,(H,22,26)(H,24,27) |
| InChIKey | OBPYRLSZNVBTLS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |