C20H20N4O3 — CID 50815635
3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-(pyridin-3-ylmethyl)propanamide (PubChem CID 50815635) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-(pyridin-3-ylmethyl)propanamide.
| Compound Name | 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-(pyridin-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 50815635 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-(pyridin-3-ylmethyl)propanamide |
| SMILES | C=CCn1c(=O)c(=O)n(CCC(=O)NCc2cccnc2)c2ccccc21 |
| InChI | InChI=1S/C20H20N4O3/c1-2-11-23-16-7-3-4-8-17(16)24(20(27)19(23)26)12-9-18(25)22-14-15-6-5-10-21-13-15/h2-8,10,13H,1,9,11-12,14H2,(H,22,25) |
| InChIKey | KBLRDOBYPQSZHR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|