C22H30N4O3 — CID 50815536
3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-(3-piperidin-1-ylpropyl)propanamide (PubChem CID 50815536) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-(3-piperidin-1-ylpropyl)propanamide.
| Compound Name | 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-(3-piperidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 50815536 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-(3-piperidin-1-ylpropyl)propanamide |
| SMILES | C=CCn1c(=O)c(=O)n(CCC(=O)NCCCN2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C22H30N4O3/c1-2-13-25-18-9-4-5-10-19(18)26(22(29)21(25)28)17-11-20(27)23-12-8-16-24-14-6-3-7-15-24/h2,4-5,9-10H,1,3,6-8,11-17H2,(H,23,27) |
| InChIKey | ZWPDKKBOMUFNAK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|