C22H33N5O2 — CID 46324456
3-(3-methyl-2-oxoquinoxalin-1-yl)-N-[3-(4-propylpiperazin-1-yl)propyl]propanamide (PubChem CID 46324456) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 3-(3-methyl-2-oxoquinoxalin-1-yl)-N-[3-(4-propylpiperazin-1-yl)propyl]propanamide.
| Compound Name | 3-(3-methyl-2-oxoquinoxalin-1-yl)-N-[3-(4-propylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 46324456 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | 3-(3-methyl-2-oxoquinoxalin-1-yl)-N-[3-(4-propylpiperazin-1-yl)propyl]propanamide |
| SMILES | CCCN1CCN(CCCNC(=O)CCn2c(=O)c(C)nc3ccccc32)CC1 |
| InChI | InChI=1S/C22H33N5O2/c1-3-11-25-14-16-26(17-15-25)12-6-10-23-21(28)9-13-27-20-8-5-4-7-19(20)24-18(2)22(27)29/h4-5,7-8H,3,6,9-17H2,1-2H3,(H,23,28) |
| InChIKey | ZGZPRPGQLBMOLX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|