C25H30ClN5O2 — CID 46324439
N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-(3-methyl-2-oxoquinoxalin-1-yl)propanamide (PubChem CID 46324439) has the molecular formula C25H30ClN5O2 and a molecular weight of 468.00 g/mol. Its IUPAC name is N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-(3-methyl-2-oxoquinoxalin-1-yl)propanamide.
| Compound Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-(3-methyl-2-oxoquinoxalin-1-yl)propanamide |
|---|---|
| PubChem CID | 46324439 |
| Molecular Formula | C25H30ClN5O2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-3-(3-methyl-2-oxoquinoxalin-1-yl)propanamide |
| SMILES | Cc1nc2ccccc2n(CCC(=O)NCCCN2CCN(c3cccc(Cl)c3)CC2)c1=O |
| InChI | InChI=1S/C25H30ClN5O2/c1-19-25(33)31(23-9-3-2-8-22(23)28-19)13-10-24(32)27-11-5-12-29-14-16-30(17-15-29)21-7-4-6-20(26)18-21/h2-4,6-9,18H,5,10-17H2,1H3,(H,27,32) |
| InChIKey | UBWYJDZVRARNOK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|