C28H37N5O3 — CID 46324607
N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide (PubChem CID 46324607) has the molecular formula C28H37N5O3 and a molecular weight of 491.64 g/mol. Its IUPAC name is N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide.
| Compound Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide |
|---|---|
| PubChem CID | 46324607 |
| Molecular Formula | C28H37N5O3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)CCn3c(=O)c(C)nc4cc(C)c(C)cc43)CC2)cc1 |
| InChI | InChI=1S/C28H37N5O3/c1-20-18-25-26(19-21(20)2)33(28(35)22(3)30-25)13-10-27(34)29-11-5-12-31-14-16-32(17-15-31)23-6-8-24(36-4)9-7-23/h6-9,18-19H,5,10-17H2,1-4H3,(H,29,34) |
| InChIKey | CKNGPFTXTDEVMW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|