C23H34N4O2 — CID 46324603
N-[3-(2-methylpiperidin-1-yl)propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide (PubChem CID 46324603) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is N-[3-(2-methylpiperidin-1-yl)propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide.
| Compound Name | N-[3-(2-methylpiperidin-1-yl)propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide |
|---|---|
| PubChem CID | 46324603 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N-[3-(2-methylpiperidin-1-yl)propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide |
| SMILES | Cc1cc2nc(C)c(=O)n(CCC(=O)NCCCN3CCCCC3C)c2cc1C |
| InChI | InChI=1S/C23H34N4O2/c1-16-14-20-21(15-17(16)2)27(23(29)19(4)25-20)13-9-22(28)24-10-7-12-26-11-6-5-8-18(26)3/h14-15,18H,5-13H2,1-4H3,(H,24,28) |
| InChIKey | KNMMZKWIFSNFST-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|