C21H23N3O2 — CID 46324586
N-(4-methylphenyl)-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide (PubChem CID 46324586) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-(4-methylphenyl)-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide.
| Compound Name | N-(4-methylphenyl)-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide |
|---|---|
| PubChem CID | 46324586 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-(4-methylphenyl)-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCn2c(=O)c(C)nc3cc(C)c(C)cc32)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-13-5-7-17(8-6-13)23-20(25)9-10-24-19-12-15(3)14(2)11-18(19)22-16(4)21(24)26/h5-8,11-12H,9-10H2,1-4H3,(H,23,25) |
| InChIKey | GMTYUIVGVPBOPC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |