C22H25N3O2 — CID 46324557
N-(3-ethylphenyl)-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide (PubChem CID 46324557) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-(3-ethylphenyl)-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide.
| Compound Name | N-(3-ethylphenyl)-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide |
|---|---|
| PubChem CID | 46324557 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-(3-ethylphenyl)-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide |
| SMILES | CCc1cccc(NC(=O)CCn2c(=O)c(C)nc3cc(C)c(C)cc32)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-5-17-7-6-8-18(13-17)24-21(26)9-10-25-20-12-15(3)14(2)11-19(20)23-16(4)22(25)27/h6-8,11-13H,5,9-10H2,1-4H3,(H,24,26) |
| InChIKey | FXDKXEOSIKEHAA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |