C27H34FN5O2 — CID 46324614
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide (PubChem CID 46324614) has the molecular formula C27H34FN5O2 and a molecular weight of 479.60 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide |
|---|---|
| PubChem CID | 46324614 |
| Molecular Formula | C27H34FN5O2 |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-3-(3,6,7-trimethyl-2-oxoquinoxalin-1-yl)propanamide |
| SMILES | Cc1cc2nc(C)c(=O)n(CCC(=O)NCCCN3CCN(c4ccc(F)cc4)CC3)c2cc1C |
| InChI | InChI=1S/C27H34FN5O2/c1-19-17-24-25(18-20(19)2)33(27(35)21(3)30-24)12-9-26(34)29-10-4-11-31-13-15-32(16-14-31)23-7-5-22(28)6-8-23/h5-8,17-18H,4,9-16H2,1-3H3,(H,29,34) |
| InChIKey | RQAQXXWFJWBBRJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|