C28H32FN5O2 — CID 22522650
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-(4-oxopyrrolo[1,2-a]quinoxalin-5-yl)butanamide (PubChem CID 22522650) has the molecular formula C28H32FN5O2 and a molecular weight of 489.60 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-(4-oxopyrrolo[1,2-a]quinoxalin-5-yl)butanamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-(4-oxopyrrolo[1,2-a]quinoxalin-5-yl)butanamide |
|---|---|
| PubChem CID | 22522650 |
| Molecular Formula | C28H32FN5O2 |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-(4-oxopyrrolo[1,2-a]quinoxalin-5-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)c2cccn2c2ccccc21)NCCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H32FN5O2/c29-22-10-12-23(13-11-22)32-20-18-31(19-21-32)15-5-14-30-27(35)9-4-17-34-25-7-2-1-6-24(25)33-16-3-8-26(33)28(34)36/h1-3,6-8,10-13,16H,4-5,9,14-15,17-21H2,(H,30,35) |
| InChIKey | WVSNWLMYFYJHDV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|