C22H25FN4O — CID 139617104
1-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-3-methylquinoxalin-2-one (PubChem CID 139617104) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-3-methylquinoxalin-2-one.
| Compound Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-3-methylquinoxalin-2-one |
|---|---|
| PubChem CID | 139617104 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-3-methylquinoxalin-2-one |
| SMILES | Cc1nc2ccccc2n(CCCN2CCN(c3ccc(F)cc3)CC2)c1=O |
| InChI | InChI=1S/C22H25FN4O/c1-17-22(28)27(21-6-3-2-5-20(21)24-17)12-4-11-25-13-15-26(16-14-25)19-9-7-18(23)8-10-19/h2-3,5-10H,4,11-16H2,1H3 |
| InChIKey | UDLQNRNWJXSHIF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |