C27H31FN4O3 — CID 50815802
3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]propanamide (PubChem CID 50815802) has the molecular formula C27H31FN4O3 and a molecular weight of 478.57 g/mol. Its IUPAC name is 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]propanamide.
| Compound Name | 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 50815802 |
| Molecular Formula | C27H31FN4O3 |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 3-(2,3-dioxo-4-prop-2-enylquinoxalin-1-yl)-N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]propanamide |
| SMILES | C=CCn1c(=O)c(=O)n(CCC(=O)NCC2CCN(Cc3ccccc3F)CC2)c2ccccc21 |
| InChI | InChI=1S/C27H31FN4O3/c1-2-14-31-23-9-5-6-10-24(23)32(27(35)26(31)34)17-13-25(33)29-18-20-11-15-30(16-12-20)19-21-7-3-4-8-22(21)28/h2-10,20H,1,11-19H2,(H,29,33) |
| InChIKey | BASPVCBSDQZAQT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|