C18H25FN2OS — CID 71991294
N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]thiolane-2-carboxamide (PubChem CID 71991294) has the molecular formula C18H25FN2OS and a molecular weight of 336.48 g/mol. Its IUPAC name is N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]thiolane-2-carboxamide.
| Compound Name | N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]thiolane-2-carboxamide |
|---|---|
| PubChem CID | 71991294 |
| Molecular Formula | C18H25FN2OS |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-[[1-[(2-fluorophenyl)methyl]piperidin-4-yl]methyl]thiolane-2-carboxamide |
| SMILES | O=C(NCC1CCN(Cc2ccccc2F)CC1)C1CCCS1 |
| InChI | InChI=1S/C18H25FN2OS/c19-16-5-2-1-4-15(16)13-21-9-7-14(8-10-21)12-20-18(22)17-6-3-11-23-17/h1-2,4-5,14,17H,3,6-13H2,(H,20,22) |
| InChIKey | QQKHZCBOVXOPON-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |