C16H29FN2O — CID 145081526
ethane;1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine;hydrate (PubChem CID 145081526) has the molecular formula C16H29FN2O and a molecular weight of 284.42 g/mol. Its IUPAC name is ethane;1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine;hydrate.
| Compound Name | ethane;1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine;hydrate |
|---|---|
| PubChem CID | 145081526 |
| Molecular Formula | C16H29FN2O |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | ethane;1-[1-[(2-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine;hydrate |
| SMILES | CC.CNCC1CCN(Cc2ccccc2F)CC1.O |
| InChI | InChI=1S/C14H21FN2.C2H6.H2O/c1-16-10-12-6-8-17(9-7-12)11-13-4-2-3-5-14(13)15;1-2;/h2-5,12,16H,6-11H2,1H3;1-2H3;1H2 |
| InChIKey | JDUSXXIZYQVZLZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |