About [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride
[1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride (PubChem CID 90647197) has the molecular formula C12H23Cl2FN2O2
and a molecular weight of 317.23 g/mol. Its IUPAC name is [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride.
Molecular Properties
| Compound Name | [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride |
| PubChem CID | 90647197 |
| Molecular Formula | C12H23Cl2FN2O2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride |
| SMILES | Cl.Cl.NCC1CCN(Cc2ccccc2F)C1.O.O |
| InChI | InChI=1S/C12H17FN2.2ClH.2H2O/c13-12-4-2-1-3-11(12)9-15-6-5-10(7-14)8-15;;;;/h1-4,10H,5-9,14H2;2*1H;2*1H2 |
| InChIKey | QYSINVBWNWBFHW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride?
The IUPAC name of [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride (CID 90647197) is [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride.
What is the SMILES notation for [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride?
The canonical SMILES for [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride is Cl.Cl.NCC1CCN(Cc2ccccc2F)C1.O.O.
What is the InChIKey of [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride?
The InChIKey is QYSINVBWNWBFHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17FN2.2ClH.2H2O/c13-12-4-2-1-3-11(12)9-15-6-5-10(7-14)8-15;;;;/h1-4,10H,5-9,14H2;2*1H;2*1H2.
What are the key properties of [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride?
[1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride has a molecular weight of 317.23 g/mol, XLogP of 0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(2-fluorophenyl)methyl]pyrrolidin-3-yl]methanamine;dihydrate;dihydrochloride is sourced from PubChem (CID 90647197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).