C12H18N2O2 — CID 62069266
4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]benzene-1,3-diol (PubChem CID 62069266) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]benzene-1,3-diol.
| Compound Name | 4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 62069266 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 4-[[3-(aminomethyl)pyrrolidin-1-yl]methyl]benzene-1,3-diol |
| SMILES | NCC1CCN(Cc2ccc(O)cc2O)C1 |
| InChI | InChI=1S/C12H18N2O2/c13-6-9-3-4-14(7-9)8-10-1-2-11(15)5-12(10)16/h1-2,5,9,15-16H,3-4,6-8,13H2 |
| InChIKey | DOBMWCMHLLASAV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|