C11H16N2O2 — CID 62069032
4-[(3-aminopyrrolidin-1-yl)methyl]benzene-1,3-diol (PubChem CID 62069032) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-[(3-aminopyrrolidin-1-yl)methyl]benzene-1,3-diol.
| Compound Name | 4-[(3-aminopyrrolidin-1-yl)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 62069032 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 4-[(3-aminopyrrolidin-1-yl)methyl]benzene-1,3-diol |
| SMILES | NC1CCN(Cc2ccc(O)cc2O)C1 |
| InChI | InChI=1S/C11H16N2O2/c12-9-3-4-13(7-9)6-8-1-2-10(14)5-11(8)15/h1-2,5,9,14-15H,3-4,6-7,12H2 |
| InChIKey | SEHHARYEUFDYQX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|