C14H21BrClFN2 — CID 120838824
1-[1-[(2-bromo-6-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine;hydrochloride (PubChem CID 120838824) has the molecular formula C14H21BrClFN2 and a molecular weight of 351.69 g/mol. Its IUPAC name is 1-[1-[(2-bromo-6-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-[(2-bromo-6-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 120838824 |
| Molecular Formula | C14H21BrClFN2 |
| Molecular Weight | 351.69 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-[1-[(2-bromo-6-fluorophenyl)methyl]piperidin-4-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1CCN(Cc2c(F)cccc2Br)CC1.Cl |
| InChI | InChI=1S/C14H20BrFN2.ClH/c1-17-9-11-5-7-18(8-6-11)10-12-13(15)3-2-4-14(12)16;/h2-4,11,17H,5-10H2,1H3;1H |
| InChIKey | IRSBUSMJIWYBQG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.69 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |